C15H18Cl2N2O4 — CID 88791160
1-(2,5-dioxoimidazolidin-1-yl)but-3-enyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88791160) has the molecular formula C15H18Cl2N2O4 and a molecular weight of 361.23 g/mol. Its IUPAC name is 1-(2,5-dioxoimidazolidin-1-yl)but-3-enyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | 1-(2,5-dioxoimidazolidin-1-yl)but-3-enyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88791160 |
| Molecular Formula | C15H18Cl2N2O4 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 1-(2,5-dioxoimidazolidin-1-yl)but-3-enyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C=CCC(OC(=O)C1C(C=C(Cl)Cl)C1(C)C)N1C(=O)CNC1=O |
| InChI | InChI=1S/C15H18Cl2N2O4/c1-4-5-11(19-10(20)7-18-14(19)22)23-13(21)12-8(6-9(16)17)15(12,2)3/h4,6,8,11-12H,1,5,7H2,2-3H3,(H,18,22) |
| InChIKey | KZYFXLNVADJONY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|