potassium 4-(carboxymethoxy)-4-oxobutanoate

C6H7KO6 — CID 88795342

IUPACpotassium 4-(carboxymethoxy)-4-oxobutanoate
SMILESO=C([O-])CCC(=O)OCC(=O)O.[K+]
InChIInChI=1S/C6H8O6.K/c7-4(8)1-2-6(11)12-3-5(9)10;/h1-3H2,(H,7,8)(H,9,10);/q;+1/p-1
InChIKeyWYHZPVNLWBBKDE-UHFFFAOYSA-M
MW214.21 g/mol
LogP-4.85
Rot. Bonds5

About potassium 4-(carboxymethoxy)-4-oxobutanoate

potassium 4-(carboxymethoxy)-4-oxobutanoate (PubChem CID 88795342) has the molecular formula C6H7KO6 and a molecular weight of 214.21 g/mol. Its IUPAC name is potassium 4-(carboxymethoxy)-4-oxobutanoate.

Molecular Properties

Compound Namepotassium 4-(carboxymethoxy)-4-oxobutanoate
PubChem CID88795342
Molecular FormulaC6H7KO6
Molecular Weight214.21 g/mol
Exact Mass213.99
IUPAC Namepotassium 4-(carboxymethoxy)-4-oxobutanoate
SMILESO=C([O-])CCC(=O)OCC(=O)O.[K+]
InChIInChI=1S/C6H8O6.K/c7-4(8)1-2-6(11)12-3-5(9)10;/h1-3H2,(H,7,8)(H,9,10);/q;+1/p-1
InChIKeyWYHZPVNLWBBKDE-UHFFFAOYSA-M
XLogP-4.85
TPSA103.73 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.21
LogP ≤ 5-4.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze potassium 4-(carboxymethoxy)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 4-(carboxymethoxy)-4-oxobutanoate?
The IUPAC name of potassium 4-(carboxymethoxy)-4-oxobutanoate (CID 88795342) is potassium 4-(carboxymethoxy)-4-oxobutanoate.
What is the SMILES notation for potassium 4-(carboxymethoxy)-4-oxobutanoate?
The canonical SMILES for potassium 4-(carboxymethoxy)-4-oxobutanoate is O=C([O-])CCC(=O)OCC(=O)O.[K+].
What is the InChIKey of potassium 4-(carboxymethoxy)-4-oxobutanoate?
The InChIKey is WYHZPVNLWBBKDE-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8O6.K/c7-4(8)1-2-6(11)12-3-5(9)10;/h1-3H2,(H,7,8)(H,9,10);/q;+1/p-1.
What are the key properties of potassium 4-(carboxymethoxy)-4-oxobutanoate?
potassium 4-(carboxymethoxy)-4-oxobutanoate has a molecular weight of 214.21 g/mol, XLogP of -4.85, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 4-(carboxymethoxy)-4-oxobutanoate is sourced from PubChem (CID 88795342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).