C18H27N5O3S — CID 8879575
2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(3-methyl-2-pentylcyclopent-2-en-1-ylidene)amino]acetamide (PubChem CID 8879575) has the molecular formula C18H27N5O3S and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(3-methyl-2-pentylcyclopent-2-en-1-ylidene)amino]acetamide.
| Compound Name | 2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(3-methyl-2-pentylcyclopent-2-en-1-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 8879575 |
| Molecular Formula | C18H27N5O3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(3-methyl-2-pentylcyclopent-2-en-1-ylidene)amino]acetamide |
| SMILES | CCCCCC1=C(C)CC/C1=N/NC(=O)CSc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C18H27N5O3S/c1-5-6-7-8-13-12(2)9-10-14(13)19-20-15(24)11-27-16-17(25)22(3)18(26)23(4)21-16/h5-11H2,1-4H3,(H,20,24)/b19-14- |
| InChIKey | RQNHZWDCVKYZFE-RGEXLXHISA-N |
| XLogP | 1.73 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|