C14H21N5O4S — CID 8968571
2-cyclopentyl-N'-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetyl]acetohydrazide (PubChem CID 8968571) has the molecular formula C14H21N5O4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-cyclopentyl-N'-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetyl]acetohydrazide.
| Compound Name | 2-cyclopentyl-N'-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetyl]acetohydrazide |
|---|---|
| PubChem CID | 8968571 |
| Molecular Formula | C14H21N5O4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-cyclopentyl-N'-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetyl]acetohydrazide |
| SMILES | Cn1nc(SCC(=O)NNC(=O)CC2CCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H21N5O4S/c1-18-13(22)12(17-19(2)14(18)23)24-8-11(21)16-15-10(20)7-9-5-3-4-6-9/h9H,3-8H2,1-2H3,(H,15,20)(H,16,21) |
| InChIKey | CWCHWBYOOLFNDE-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|