C13H17N5O4S — CID 8968601
(2E,4E)-N'-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetyl]hexa-2,4-dienehydrazide (PubChem CID 8968601) has the molecular formula C13H17N5O4S and a molecular weight of 339.38 g/mol. Its IUPAC name is (2E,4E)-N'-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetyl]hexa-2,4-dienehydrazide.
| Compound Name | (2E,4E)-N'-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetyl]hexa-2,4-dienehydrazide |
|---|---|
| PubChem CID | 8968601 |
| Molecular Formula | C13H17N5O4S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2E,4E)-N'-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetyl]hexa-2,4-dienehydrazide |
| SMILES | C/C=C/C=C/C(=O)NNC(=O)CSc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H17N5O4S/c1-4-5-6-7-9(19)14-15-10(20)8-23-11-12(21)17(2)13(22)18(3)16-11/h4-7H,8H2,1-3H3,(H,14,19)(H,15,20)/b5-4+,7-6+ |
| InChIKey | JPUYMFYKFDJPLI-YTXTXJHMSA-N |
| XLogP | -1.15 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|