C12H16BrN3O5S — CID 88796038
[2-[[amino-(methoxycarbonylamino)methylidene]amino]-1-(2-bromophenyl)ethyl] methanesulfonate (PubChem CID 88796038) has the molecular formula C12H16BrN3O5S and a molecular weight of 394.25 g/mol. Its IUPAC name is [2-[[amino-(methoxycarbonylamino)methylidene]amino]-1-(2-bromophenyl)ethyl] methanesulfonate.
| Compound Name | [2-[[amino-(methoxycarbonylamino)methylidene]amino]-1-(2-bromophenyl)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 88796038 |
| Molecular Formula | C12H16BrN3O5S |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | [2-[[amino-(methoxycarbonylamino)methylidene]amino]-1-(2-bromophenyl)ethyl] methanesulfonate |
| SMILES | COC(=O)N/C(N)=N/CC(OS(C)(=O)=O)c1ccccc1Br |
| InChI | InChI=1S/C12H16BrN3O5S/c1-20-12(17)16-11(14)15-7-10(21-22(2,18)19)8-5-3-4-6-9(8)13/h3-6,10H,7H2,1-2H3,(H3,14,15,16,17) |
| InChIKey | SAKQDCOKQQPEBP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|