C13H16BrN3O5 — CID 70608448
methyl N-[N'-[2-(2-bromophenyl)-2-hydroxyethyl]-N-methoxycarbonylcarbamimidoyl]carbamate (PubChem CID 70608448) has the molecular formula C13H16BrN3O5 and a molecular weight of 374.19 g/mol. Its IUPAC name is methyl N-[N'-[2-(2-bromophenyl)-2-hydroxyethyl]-N-methoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | methyl N-[N'-[2-(2-bromophenyl)-2-hydroxyethyl]-N-methoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 70608448 |
| Molecular Formula | C13H16BrN3O5 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | methyl N-[N'-[2-(2-bromophenyl)-2-hydroxyethyl]-N-methoxycarbonylcarbamimidoyl]carbamate |
| SMILES | COC(=O)NC(=NCC(O)c1ccccc1Br)NC(=O)OC |
| InChI | InChI=1S/C13H16BrN3O5/c1-21-12(19)16-11(17-13(20)22-2)15-7-10(18)8-5-3-4-6-9(8)14/h3-6,10,18H,7H2,1-2H3,(H2,15,16,17,19,20) |
| InChIKey | WTWZYQXBOHQORA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|