C16H16N2O4S2 — CID 88797722
prop-1-en-2-yl 2-[7-oxo-4-(phenoxymethyl)-2,3-dithia-5,8-diazabicyclo[4.2.0]oct-4-en-8-yl]acetate (PubChem CID 88797722) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is prop-1-en-2-yl 2-[7-oxo-4-(phenoxymethyl)-2,3-dithia-5,8-diazabicyclo[4.2.0]oct-4-en-8-yl]acetate.
| Compound Name | prop-1-en-2-yl 2-[7-oxo-4-(phenoxymethyl)-2,3-dithia-5,8-diazabicyclo[4.2.0]oct-4-en-8-yl]acetate |
|---|---|
| PubChem CID | 88797722 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | prop-1-en-2-yl 2-[7-oxo-4-(phenoxymethyl)-2,3-dithia-5,8-diazabicyclo[4.2.0]oct-4-en-8-yl]acetate |
| SMILES | C=C(C)OC(=O)CN1C(=O)C2N=C(COc3ccccc3)SSC21 |
| InChI | InChI=1S/C16H16N2O4S2/c1-10(2)22-13(19)8-18-15(20)14-16(18)24-23-12(17-14)9-21-11-6-4-3-5-7-11/h3-7,14,16H,1,8-9H2,2H3 |
| InChIKey | VXRAOZRWOIFACE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|