About bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+)
bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+) (PubChem CID 88799729) has the molecular formula C22H32O4S4Sn
and a molecular weight of 607.47 g/mol. Its IUPAC name is bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+).
Molecular Properties
| Compound Name | bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+) |
| PubChem CID | 88799729 |
| Molecular Formula | C22H32O4S4Sn |
| Molecular Weight | 607.47 g/mol |
| Exact Mass | 608.02 |
| IUPAC Name | bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+) |
| SMILES | CCCCOC(=S)C1=C(C(=O)[S-])CC1.CCCCOC(=S)C1=C(C(=O)[S-])CC1.C[Sn+2]C |
| InChI | InChI=1S/2C10H14O2S2.2CH3.Sn/c2*1-2-3-6-12-10(14)8-5-4-7(8)9(11)13;;;/h2*2-6H2,1H3,(H,11,13);2*1H3;/q;;;;+2/p-2 |
| InChIKey | CEHGKXOKMAQEDT-UHFFFAOYSA-L |
| XLogP | 5.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 607.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+)?
The IUPAC name of bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+) (CID 88799729) is bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+).
What is the SMILES notation for bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+)?
The canonical SMILES for bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+) is CCCCOC(=S)C1=C(C(=O)[S-])CC1.CCCCOC(=S)C1=C(C(=O)[S-])CC1.C[Sn+2]C.
What is the InChIKey of bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+)?
The InChIKey is CEHGKXOKMAQEDT-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H14O2S2.2CH3.Sn/c2*1-2-3-6-12-10(14)8-5-4-7(8)9(11)13;;;/h2*2-6H2,1H3,(H,11,13);2*1H3;/q;;;;+2/p-2.
What are the key properties of bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+)?
bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+) has a molecular weight of 607.47 g/mol, XLogP of 5.38, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-butoxycarbothioylcyclobutene-1-carbothioate);dimethyltin(2+) is sourced from PubChem (CID 88799729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).