About bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate
bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate (PubChem CID 88804930) has the molecular formula C15H21O6PS3
and a molecular weight of 424.50 g/mol. Its IUPAC name is bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate.
Molecular Properties
| Compound Name | bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate |
| PubChem CID | 88804930 |
| Molecular Formula | C15H21O6PS3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate |
| SMILES | C=CCC(S)C(=O)OP(OC(=O)C(S)CC=C)OC(=O)C(S)CC=C |
| InChI | InChI=1S/C15H21O6PS3/c1-4-7-10(23)13(16)19-22(20-14(17)11(24)8-5-2)21-15(18)12(25)9-6-3/h4-6,10-12,23-25H,1-3,7-9H2 |
| InChIKey | QBCIVCWDCTUWST-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate?
The IUPAC name of bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate (CID 88804930) is bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate.
What is the SMILES notation for bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate?
The canonical SMILES for bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate is C=CCC(S)C(=O)OP(OC(=O)C(S)CC=C)OC(=O)C(S)CC=C.
What is the InChIKey of bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate?
The InChIKey is QBCIVCWDCTUWST-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21O6PS3/c1-4-7-10(23)13(16)19-22(20-14(17)11(24)8-5-2)21-15(18)12(25)9-6-3/h4-6,10-12,23-25H,1-3,7-9H2.
What are the key properties of bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate?
bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate has a molecular weight of 424.50 g/mol, XLogP of 3.47, 12 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-sulfanylpent-4-enoyloxy)phosphanyl 2-sulfanylpent-4-enoate is sourced from PubChem (CID 88804930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).