C13H10N2O2 — CID 8880585
cyanomethyl (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate (PubChem CID 8880585) has the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. Its IUPAC name is cyanomethyl (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | cyanomethyl (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8880585 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | cyanomethyl (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C(\C#N)C(=O)OCC#N)cc1 |
| InChI | InChI=1S/C13H10N2O2/c1-10-2-4-11(5-3-10)8-12(9-15)13(16)17-7-6-14/h2-5,8H,7H2,1H3/b12-8+ |
| InChIKey | OXUVEQISLVEEJD-XYOKQWHBSA-N |
| XLogP | 1.97 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|