C8H9ClF3N3O2S — CID 88808131
3-(5-chloro-1,3-thiazol-2-yl)-3-oxido-1-(2,2,2-trifluoroethyl)imidazolidin-3-ium-4-ol (PubChem CID 88808131) has the molecular formula C8H9ClF3N3O2S and a molecular weight of 303.69 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-3-oxido-1-(2,2,2-trifluoroethyl)imidazolidin-3-ium-4-ol.
| Compound Name | 3-(5-chloro-1,3-thiazol-2-yl)-3-oxido-1-(2,2,2-trifluoroethyl)imidazolidin-3-ium-4-ol |
|---|---|
| PubChem CID | 88808131 |
| Molecular Formula | C8H9ClF3N3O2S |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 3-(5-chloro-1,3-thiazol-2-yl)-3-oxido-1-(2,2,2-trifluoroethyl)imidazolidin-3-ium-4-ol |
| SMILES | [O-][N+]1(c2ncc(Cl)s2)CN(CC(F)(F)F)CC1O |
| InChI | InChI=1S/C8H9ClF3N3O2S/c9-5-1-13-7(18-5)15(17)4-14(2-6(15)16)3-8(10,11)12/h1,6,16H,2-4H2 |
| InChIKey | NMRSPYMBFMAIRH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|