C20H36N6O2 — CID 88810761
2-(tert-butyldiazenyl)-5-[4-(tert-butyldiazenyl)-4-cyanopentyl]peroxy-2-methylpentanenitrile (PubChem CID 88810761) has the molecular formula C20H36N6O2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-(tert-butyldiazenyl)-5-[4-(tert-butyldiazenyl)-4-cyanopentyl]peroxy-2-methylpentanenitrile.
| Compound Name | 2-(tert-butyldiazenyl)-5-[4-(tert-butyldiazenyl)-4-cyanopentyl]peroxy-2-methylpentanenitrile |
|---|---|
| PubChem CID | 88810761 |
| Molecular Formula | C20H36N6O2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 2-(tert-butyldiazenyl)-5-[4-(tert-butyldiazenyl)-4-cyanopentyl]peroxy-2-methylpentanenitrile |
| SMILES | CC(C)(C)/N=N/C(C)(C#N)CCCOOCCCC(C)(C#N)/N=N/C(C)(C)C |
| InChI | InChI=1S/C20H36N6O2/c1-17(2,3)23-25-19(7,15-21)11-9-13-27-28-14-10-12-20(8,16-22)26-24-18(4,5)6/h9-14H2,1-8H3/b25-23+,26-24+ |
| InChIKey | FMMIQQQRCWNUST-OGGGYYITSA-N |
| XLogP | 5.56 |
| TPSA | 115.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|