About methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate
methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate (PubChem CID 88815737) has the molecular formula C13H27N3O2S2
and a molecular weight of 321.51 g/mol. Its IUPAC name is methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate.
Molecular Properties
| Compound Name | methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate |
| PubChem CID | 88815737 |
| Molecular Formula | C13H27N3O2S2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate |
| SMILES | CCCCSN(SCCCC)C(=O)N/C(=N/CC)OC |
| InChI | InChI=1S/C13H27N3O2S2/c1-5-8-10-19-16(20-11-9-6-2)13(17)15-12(18-4)14-7-3/h5-11H2,1-4H3,(H,14,15,17) |
| InChIKey | AGZLGMDNNYHYOI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate?
The IUPAC name of methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate (CID 88815737) is methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate.
What is the SMILES notation for methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate?
The canonical SMILES for methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate is CCCCSN(SCCCC)C(=O)N/C(=N/CC)OC.
What is the InChIKey of methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate?
The InChIKey is AGZLGMDNNYHYOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2S2/c1-5-8-10-19-16(20-11-9-6-2)13(17)15-12(18-4)14-7-3/h5-11H2,1-4H3,(H,14,15,17).
What are the key properties of methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate?
methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate has a molecular weight of 321.51 g/mol, XLogP of 3.92, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[bis(butylsulfanyl)carbamoyl]-N'-ethylcarbamimidate is sourced from PubChem (CID 88815737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).