C19H19NO5S — CID 88822788
(2Z)-2-hydroxyimino-5-(methylsulfonylmethyl)-6-phenylmethoxy-3,4-dihydronaphthalen-1-one (PubChem CID 88822788) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2Z)-2-hydroxyimino-5-(methylsulfonylmethyl)-6-phenylmethoxy-3,4-dihydronaphthalen-1-one.
| Compound Name | (2Z)-2-hydroxyimino-5-(methylsulfonylmethyl)-6-phenylmethoxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 88822788 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (2Z)-2-hydroxyimino-5-(methylsulfonylmethyl)-6-phenylmethoxy-3,4-dihydronaphthalen-1-one |
| SMILES | CS(=O)(=O)Cc1c(OCc2ccccc2)ccc2c1CC/C(=N/O)C2=O |
| InChI | InChI=1S/C19H19NO5S/c1-26(23,24)12-16-14-7-9-17(20-22)19(21)15(14)8-10-18(16)25-11-13-5-3-2-4-6-13/h2-6,8,10,22H,7,9,11-12H2,1H3/b20-17- |
| InChIKey | LCOULPFPSQZMPV-JZJYNLBNSA-N |
| XLogP | 2.77 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|