C27H27LiO — CID 88823326
lithium [[(5Z)-octa-1,5-dien-3-yl]oxy-diphenylmethyl]benzene (PubChem CID 88823326) has the molecular formula C27H27LiO and a molecular weight of 374.45 g/mol. Its IUPAC name is lithium [[(5Z)-octa-1,5-dien-3-yl]oxy-diphenylmethyl]benzene.
| Compound Name | lithium [[(5Z)-octa-1,5-dien-3-yl]oxy-diphenylmethyl]benzene |
|---|---|
| PubChem CID | 88823326 |
| Molecular Formula | C27H27LiO |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | lithium [[(5Z)-octa-1,5-dien-3-yl]oxy-diphenylmethyl]benzene |
| SMILES | [H]/[C-]=C\C(C/C=C\CC)OC(c1ccccc1)(c1ccccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C27H27O.Li/c1-3-5-9-22-26(4-2)28-27(23-16-10-6-11-17-23,24-18-12-7-13-19-24)25-20-14-8-15-21-25;/h2,4-21,26H,3,22H2,1H3;/q-1;+1/b9-5-; |
| InChIKey | DMQRFKRJUROAOO-UYTGOYFPSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|