C10H11NOS — CID 88823942
2-benzyl-1,2-oxazolidine-3-thione (PubChem CID 88823942) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-benzyl-1,2-oxazolidine-3-thione.
| Compound Name | 2-benzyl-1,2-oxazolidine-3-thione |
|---|---|
| PubChem CID | 88823942 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-benzyl-1,2-oxazolidine-3-thione |
| SMILES | S=C1CCON1Cc1ccccc1 |
| InChI | InChI=1S/C10H11NOS/c13-10-6-7-12-11(10)8-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | BZCSFKIFNVCZNS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|