About 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide
4-sulfanylcyclohex-4-ene-1,2-dicarboxamide (PubChem CID 88830809) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide |
| PubChem CID | 88830809 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide |
| SMILES | NC(=O)C1CC=C(S)CC1C(N)=O |
| InChI | InChI=1S/C8H12N2O2S/c9-7(11)5-2-1-4(13)3-6(5)8(10)12/h1,5-6,13H,2-3H2,(H2,9,11)(H2,10,12) |
| InChIKey | VKXGOSWMHRIWQL-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide?
The IUPAC name of 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide (CID 88830809) is 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide.
What is the SMILES notation for 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide?
The canonical SMILES for 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide is NC(=O)C1CC=C(S)CC1C(N)=O.
What is the InChIKey of 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide?
The InChIKey is VKXGOSWMHRIWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c9-7(11)5-2-1-4(13)3-6(5)8(10)12/h1,5-6,13H,2-3H2,(H2,9,11)(H2,10,12).
What are the key properties of 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide?
4-sulfanylcyclohex-4-ene-1,2-dicarboxamide has a molecular weight of 200.26 g/mol, XLogP of -0.20, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanylcyclohex-4-ene-1,2-dicarboxamide is sourced from PubChem (CID 88830809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).