About diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate
diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate (PubChem CID 88831077) has the molecular formula C14H18Cl2N2O3
and a molecular weight of 333.22 g/mol. Its IUPAC name is diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate.
Molecular Properties
| Compound Name | diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate |
| PubChem CID | 88831077 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate |
| SMILES | CCN(CC)C(=O)O/C(=N\OC)C(Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18Cl2N2O3/c1-4-18(5-2)14(19)21-13(17-20-3)12(16)10-6-8-11(15)9-7-10/h6-9,12H,4-5H2,1-3H3/b17-13- |
| InChIKey | JOHWEBVPIPCUHR-LGMDPLHJSA-N |
| XLogP | 4.06 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate?
The IUPAC name of diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate (CID 88831077) is diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate.
What is the SMILES notation for diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate?
The canonical SMILES for diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate is CCN(CC)C(=O)O/C(=N\OC)C(Cl)c1ccc(Cl)cc1.
What is the InChIKey of diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate?
The InChIKey is JOHWEBVPIPCUHR-LGMDPLHJSA-N. The full InChI is InChI=1S/C14H18Cl2N2O3/c1-4-18(5-2)14(19)21-13(17-20-3)12(16)10-6-8-11(15)9-7-10/h6-9,12H,4-5H2,1-3H3/b17-13-.
What are the key properties of diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate?
diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate has a molecular weight of 333.22 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethylcarbamoyl (1Z)-2-chloro-2-(4-chlorophenyl)-N-methoxyethanimidate is sourced from PubChem (CID 88831077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).