C10H10N2O — CID 88832954
1,2,4,5-tetrahydro-1,2-benzodiazepin-3-ylidenemethanone (PubChem CID 88832954) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 1,2,4,5-tetrahydro-1,2-benzodiazepin-3-ylidenemethanone.
| Compound Name | 1,2,4,5-tetrahydro-1,2-benzodiazepin-3-ylidenemethanone |
|---|---|
| PubChem CID | 88832954 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 1,2,4,5-tetrahydro-1,2-benzodiazepin-3-ylidenemethanone |
| SMILES | O=C=C1CCc2ccccc2NN1 |
| InChI | InChI=1S/C10H10N2O/c13-7-9-6-5-8-3-1-2-4-10(8)12-11-9/h1-4,11-12H,5-6H2 |
| InChIKey | XCLXFHNSDXTRPG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|