C10H11NO2 — CID 176520579
3,4-dihydro-2H-isoquinolin-1-ylidenemethanone;hydrate (PubChem CID 176520579) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 3,4-dihydro-2H-isoquinolin-1-ylidenemethanone;hydrate.
| Compound Name | 3,4-dihydro-2H-isoquinolin-1-ylidenemethanone;hydrate |
|---|---|
| PubChem CID | 176520579 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 3,4-dihydro-2H-isoquinolin-1-ylidenemethanone;hydrate |
| SMILES | O.O=C=C1NCCc2ccccc21 |
| InChI | InChI=1S/C10H9NO.H2O/c12-7-10-9-4-2-1-3-8(9)5-6-11-10;/h1-4,11H,5-6H2;1H2 |
| InChIKey | WABCOTYDNFIRKG-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|