C7H8N2 — CID 18184083
2,3-dihydro-1H-indazole (PubChem CID 18184083) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 2,3-dihydro-1H-indazole.
| Compound Name | 2,3-dihydro-1H-indazole |
|---|---|
| PubChem CID | 18184083 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 2,3-dihydro-1H-indazole |
| SMILES | c1ccc2c(c1)CNN2 |
| InChI | InChI=1S/C7H8N2/c1-2-4-7-6(3-1)5-8-9-7/h1-4,8-9H,5H2 |
| InChIKey | QDKGOMZIPXGDDJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |