ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen

C10H18N2 — CID 143489655

IUPACethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen
SMILESCC.Cc1ccc2c(c1)CNN2.[H][H]
InChIInChI=1S/C8H10N2.C2H6.H2/c1-6-2-3-8-7(4-6)5-9-10-8;1-2;/h2-4,9-10H,5H2,1H3;1-2H3;1H
InChIKeyUCQGGXLHSIDGSD-UHFFFAOYSA-N
MW166.27 g/mol
LogP2.70
Rot. Bonds

About ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen

ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen (PubChem CID 143489655) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen.

Molecular Properties

Compound Nameethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen
PubChem CID143489655
Molecular FormulaC10H18N2
Molecular Weight166.27 g/mol
Exact Mass166.15
IUPAC Nameethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen
SMILESCC.Cc1ccc2c(c1)CNN2.[H][H]
InChIInChI=1S/C8H10N2.C2H6.H2/c1-6-2-3-8-7(4-6)5-9-10-8;1-2;/h2-4,9-10H,5H2,1H3;1-2H3;1H
InChIKeyUCQGGXLHSIDGSD-UHFFFAOYSA-N
XLogP2.70
TPSA24.06 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.27
LogP ≤ 52.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen?
The IUPAC name of ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen (CID 143489655) is ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen.
What is the SMILES notation for ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen?
The canonical SMILES for ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen is CC.Cc1ccc2c(c1)CNN2.[H][H].
What is the InChIKey of ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen?
The InChIKey is UCQGGXLHSIDGSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.C2H6.H2/c1-6-2-3-8-7(4-6)5-9-10-8;1-2;/h2-4,9-10H,5H2,1H3;1-2H3;1H.
What are the key properties of ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen?
ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen has a molecular weight of 166.27 g/mol, XLogP of 2.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-2,3-dihydro-1H-indazole;molecular hydrogen is sourced from PubChem (CID 143489655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).