About CID 143637694
CID 143637694 (PubChem CID 143637694) has the molecular formula C7H7IN-
and a molecular weight of 232.04 g/mol.
Molecular Properties
| Compound Name | CID 143637694 |
| PubChem CID | 143637694 |
| Molecular Formula | C7H7IN- |
| Molecular Weight | 232.04 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)C[I-]N2 |
| InChI | InChI=1S/C7H7IN/c1-2-4-7-6(3-1)5-8-9-7/h1-4,9H,5H2/q-1 |
| InChIKey | LMAXBLDCMFNFHG-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.04 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 143637694 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143637694?
The IUPAC name of CID 143637694 (CID 143637694) is not available.
What is the SMILES notation for CID 143637694?
The canonical SMILES for CID 143637694 is c1ccc2c(c1)C[I-]N2.
What is the InChIKey of CID 143637694?
The InChIKey is LMAXBLDCMFNFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IN/c1-2-4-7-6(3-1)5-8-9-7/h1-4,9H,5H2/q-1.
What are the key properties of CID 143637694?
CID 143637694 has a molecular weight of 232.04 g/mol, XLogP of -1.38, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143637694 is sourced from PubChem (CID 143637694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).