C26H38O9S2 — CID 88834709
methyl 7-[(2S)-6-[1,2-bis(methylsulfonyloxy)-4-phenylbutyl]-3-oxo-2-bicyclo[3.1.0]hexanyl]heptanoate (PubChem CID 88834709) has the molecular formula C26H38O9S2 and a molecular weight of 558.72 g/mol. Its IUPAC name is methyl 7-[(2S)-6-[1,2-bis(methylsulfonyloxy)-4-phenylbutyl]-3-oxo-2-bicyclo[3.1.0]hexanyl]heptanoate.
| Compound Name | methyl 7-[(2S)-6-[1,2-bis(methylsulfonyloxy)-4-phenylbutyl]-3-oxo-2-bicyclo[3.1.0]hexanyl]heptanoate |
|---|---|
| PubChem CID | 88834709 |
| Molecular Formula | C26H38O9S2 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | methyl 7-[(2S)-6-[1,2-bis(methylsulfonyloxy)-4-phenylbutyl]-3-oxo-2-bicyclo[3.1.0]hexanyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(=O)CC2C1C2C(OS(C)(=O)=O)C(CCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C26H38O9S2/c1-33-23(28)14-10-5-4-9-13-19-21(27)17-20-24(19)25(20)26(35-37(3,31)32)22(34-36(2,29)30)16-15-18-11-7-6-8-12-18/h6-8,11-12,19-20,22,24-26H,4-5,9-10,13-17H2,1-3H3 |
| InChIKey | CTEAYSHOQILPKN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|