About dichloro 3-methylhexanedioate
dichloro 3-methylhexanedioate (PubChem CID 88838757) has the molecular formula C7H10Cl2O4
and a molecular weight of 229.06 g/mol. Its IUPAC name is dichloro 3-methylhexanedioate.
Molecular Properties
| Compound Name | dichloro 3-methylhexanedioate |
| PubChem CID | 88838757 |
| Molecular Formula | C7H10Cl2O4 |
| Molecular Weight | 229.06 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | dichloro 3-methylhexanedioate |
| SMILES | CC(CCC(=O)OCl)CC(=O)OCl |
| InChI | InChI=1S/C7H10Cl2O4/c1-5(4-7(11)13-9)2-3-6(10)12-8/h5H,2-4H2,1H3 |
| InChIKey | ZXPTXTXZQHPZOT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.06 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dichloro 3-methylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro 3-methylhexanedioate?
The IUPAC name of dichloro 3-methylhexanedioate (CID 88838757) is dichloro 3-methylhexanedioate.
What is the SMILES notation for dichloro 3-methylhexanedioate?
The canonical SMILES for dichloro 3-methylhexanedioate is CC(CCC(=O)OCl)CC(=O)OCl.
What is the InChIKey of dichloro 3-methylhexanedioate?
The InChIKey is ZXPTXTXZQHPZOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10Cl2O4/c1-5(4-7(11)13-9)2-3-6(10)12-8/h5H,2-4H2,1H3.
What are the key properties of dichloro 3-methylhexanedioate?
dichloro 3-methylhexanedioate has a molecular weight of 229.06 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro 3-methylhexanedioate is sourced from PubChem (CID 88838757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).