About 2-decylsulfanylacetate;tributylstannanylium
2-decylsulfanylacetate;tributylstannanylium (PubChem CID 88839676) has the molecular formula C24H50O2SSn
and a molecular weight of 521.44 g/mol. Its IUPAC name is 2-decylsulfanylacetate;tributylstannanylium.
Molecular Properties
| Compound Name | 2-decylsulfanylacetate;tributylstannanylium |
| PubChem CID | 88839676 |
| Molecular Formula | C24H50O2SSn |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 2-decylsulfanylacetate;tributylstannanylium |
| SMILES | CCCCCCCCCCSCC(=O)[O-].CCCC[Sn+](CCCC)CCCC |
| InChI | InChI=1S/C12H24O2S.3C4H9.Sn/c1-2-3-4-5-6-7-8-9-10-15-11-12(13)14;3*1-3-4-2;/h2-11H2,1H3,(H,13,14);3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | QWKWDHFEVZPCNT-UHFFFAOYSA-M |
| XLogP | 7.49 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decylsulfanylacetate;tributylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decylsulfanylacetate;tributylstannanylium?
The IUPAC name of 2-decylsulfanylacetate;tributylstannanylium (CID 88839676) is 2-decylsulfanylacetate;tributylstannanylium.
What is the SMILES notation for 2-decylsulfanylacetate;tributylstannanylium?
The canonical SMILES for 2-decylsulfanylacetate;tributylstannanylium is CCCCCCCCCCSCC(=O)[O-].CCCC[Sn+](CCCC)CCCC.
What is the InChIKey of 2-decylsulfanylacetate;tributylstannanylium?
The InChIKey is QWKWDHFEVZPCNT-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O2S.3C4H9.Sn/c1-2-3-4-5-6-7-8-9-10-15-11-12(13)14;3*1-3-4-2;/h2-11H2,1H3,(H,13,14);3*1,3-4H2,2H3;/q;;;;+1/p-1.
What are the key properties of 2-decylsulfanylacetate;tributylstannanylium?
2-decylsulfanylacetate;tributylstannanylium has a molecular weight of 521.44 g/mol, XLogP of 7.49, 20 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decylsulfanylacetate;tributylstannanylium is sourced from PubChem (CID 88839676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).