C13H10N2 — CID 88839999
7H-pyrido[2,3-g][1]benzazepine (PubChem CID 88839999) has the molecular formula C13H10N2 and a molecular weight of 194.24 g/mol. Its IUPAC name is 7H-pyrido[2,3-g][1]benzazepine.
| Compound Name | 7H-pyrido[2,3-g][1]benzazepine |
|---|---|
| PubChem CID | 88839999 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 7H-pyrido[2,3-g][1]benzazepine |
| SMILES | C1=CNc2ccc3cccnc3c2C=C1 |
| InChI | InChI=1S/C13H10N2/c1-2-8-14-12-7-6-10-4-3-9-15-13(10)11(12)5-1/h1-9,14H |
| InChIKey | OQJQVKLMBYCCCF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |