C25H40N4O4S12 — CID 88840604
[2,2-dimethyl-3,3,3-tris(morpholine-2-carbothioyldisulfanyl)propyl]sulfanyl morpholine-2-carbodithioate (PubChem CID 88840604) has the molecular formula C25H40N4O4S12 and a molecular weight of 845.42 g/mol. Its IUPAC name is [2,2-dimethyl-3,3,3-tris(morpholine-2-carbothioyldisulfanyl)propyl]sulfanyl morpholine-2-carbodithioate.
| Compound Name | [2,2-dimethyl-3,3,3-tris(morpholine-2-carbothioyldisulfanyl)propyl]sulfanyl morpholine-2-carbodithioate |
|---|---|
| PubChem CID | 88840604 |
| Molecular Formula | C25H40N4O4S12 |
| Molecular Weight | 845.42 g/mol |
| Exact Mass | 843.97 |
| IUPAC Name | [2,2-dimethyl-3,3,3-tris(morpholine-2-carbothioyldisulfanyl)propyl]sulfanyl morpholine-2-carbodithioate |
| SMILES | CC(C)(CSSC(=S)C1CNCCO1)C(SSC(=S)C1CNCCO1)(SSC(=S)C1CNCCO1)SSC(=S)C1CNCCO1 |
| InChI | InChI=1S/C25H40N4O4S12/c1-24(2,15-38-39-20(34)16-11-26-3-7-30-16)25(43-40-21(35)17-12-27-4-8-31-17,44-41-22(36)18-13-28-5-9-32-18)45-42-23(37)19-14-29-6-10-33-19/h16-19,26-29H,3-15H2,1-2H3 |
| InChIKey | HYRLWZJHYBQHQL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|