C28H37NO8S — CID 88840847
ethanesulfonic acid;(1S,17S,19S)-9-hydroxy-4,5-dimethoxy-16-oxa-24-azapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one (PubChem CID 88840847) has the molecular formula C28H37NO8S and a molecular weight of 547.67 g/mol. Its IUPAC name is ethanesulfonic acid;(1S,17S,19S)-9-hydroxy-4,5-dimethoxy-16-oxa-24-azapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one.
| Compound Name | ethanesulfonic acid;(1S,17S,19S)-9-hydroxy-4,5-dimethoxy-16-oxa-24-azapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one |
|---|---|
| PubChem CID | 88840847 |
| Molecular Formula | C28H37NO8S |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | ethanesulfonic acid;(1S,17S,19S)-9-hydroxy-4,5-dimethoxy-16-oxa-24-azapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one |
| SMILES | CCS(=O)(=O)O.COc1cc2c(cc1OC)[C@@H]1C[C@H](C[C@@H]3CCCCN31)OC(=O)CCc1ccc(O)c-2c1 |
| InChI | InChI=1S/C26H31NO5.C2H6O3S/c1-30-24-14-19-20(15-25(24)31-2)22-13-18(12-17-5-3-4-10-27(17)22)32-26(29)9-7-16-6-8-23(28)21(19)11-16;1-2-6(3,4)5/h6,8,11,14-15,17-18,22,28H,3-5,7,9-10,12-13H2,1-2H3;2H2,1H3,(H,3,4,5)/t17-,18-,22-;/m0./s1 |
| InChIKey | PCPMYAFNELXOPW-JIXBSQRZSA-N |
| XLogP | 4.52 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|