C25H29NO7 — CID 101495691
(1S,17S,19S)-4,9,13-trihydroxy-5-methoxy-24-oxido-16-oxa-24-azoniapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one (PubChem CID 101495691) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is (1S,17S,19S)-4,9,13-trihydroxy-5-methoxy-24-oxido-16-oxa-24-azoniapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one.
| Compound Name | (1S,17S,19S)-4,9,13-trihydroxy-5-methoxy-24-oxido-16-oxa-24-azoniapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one |
|---|---|
| PubChem CID | 101495691 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (1S,17S,19S)-4,9,13-trihydroxy-5-methoxy-24-oxido-16-oxa-24-azoniapentacyclo[15.7.1.18,12.02,7.019,24]hexacosa-2,4,6,8,10,12(26)-hexaen-15-one |
| SMILES | COc1cc2c(cc1O)[C@@H]1C[C@H](C[C@@H]3CCCC[N+]31[O-])OC(=O)CC(O)c1ccc(O)c-2c1 |
| InChI | InChI=1S/C25H29NO7/c1-32-24-12-17-18(11-23(24)29)20-10-16(9-15-4-2-3-7-26(15,20)31)33-25(30)13-22(28)14-5-6-21(27)19(17)8-14/h5-6,8,11-12,15-16,20,22,27-29H,2-4,7,9-10,13H2,1H3/t15-,16-,20-,22?,26?/m0/s1 |
| InChIKey | RPXGIGONGAPDMJ-DWXHBHGGSA-N |
| XLogP | 3.82 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|