C61H82N6S3 — CID 88853508
4-[5-(2-methyl-9,9-dioctylindeno[1,2-b]pyrazin-7-yl)thiophen-2-yl]-9-(5-methylthiophen-2-yl)-6,7-dioctyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 88853508) has the molecular formula C61H82N6S3 and a molecular weight of 995.57 g/mol. Its IUPAC name is 4-[5-(2-methyl-9,9-dioctylindeno[1,2-b]pyrazin-7-yl)thiophen-2-yl]-9-(5-methylthiophen-2-yl)-6,7-dioctyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4-[5-(2-methyl-9,9-dioctylindeno[1,2-b]pyrazin-7-yl)thiophen-2-yl]-9-(5-methylthiophen-2-yl)-6,7-dioctyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 88853508 |
| Molecular Formula | C61H82N6S3 |
| Molecular Weight | 995.57 g/mol |
| Exact Mass | 994.58 |
| IUPAC Name | 4-[5-(2-methyl-9,9-dioctylindeno[1,2-b]pyrazin-7-yl)thiophen-2-yl]-9-(5-methylthiophen-2-yl)-6,7-dioctyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCCCCCCc1nc2c(-c3ccc(C)s3)c3nsnc3c(-c3ccc(-c4ccc5c(c4)C(CCCCCCCC)(CCCCCCCC)c4nc(C)cnc4-5)s3)c2nc1CCCCCCCC |
| InChI | InChI=1S/C61H82N6S3/c1-7-11-15-19-23-27-31-48-49(32-28-24-20-16-12-8-2)65-57-54(59-58(66-70-67-59)53(56(57)64-48)51-36-33-44(6)68-51)52-38-37-50(69-52)45-34-35-46-47(41-45)61(39-29-25-21-17-13-9-3,40-30-26-22-18-14-10-4)60-55(46)62-42-43(5)63-60/h33-38,41-42H,7-32,39-40H2,1-6H3 |
| InChIKey | ISXLHOSJQDANJJ-UHFFFAOYSA-N |
| XLogP | 19.74 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.57 |
| LogP ≤ 5 | 19.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|