C8H7F5O4 — CID 88855721
2-acetyloxy-5,5,6,6,6-pentafluorohex-2-enoic acid (PubChem CID 88855721) has the molecular formula C8H7F5O4 and a molecular weight of 262.13 g/mol. Its IUPAC name is 2-acetyloxy-5,5,6,6,6-pentafluorohex-2-enoic acid.
| Compound Name | 2-acetyloxy-5,5,6,6,6-pentafluorohex-2-enoic acid |
|---|---|
| PubChem CID | 88855721 |
| Molecular Formula | C8H7F5O4 |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2-acetyloxy-5,5,6,6,6-pentafluorohex-2-enoic acid |
| SMILES | CC(=O)OC(=CCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H7F5O4/c1-4(14)17-5(6(15)16)2-3-7(9,10)8(11,12)13/h2H,3H2,1H3,(H,15,16) |
| InChIKey | WDCZUEHYZQOCSI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|