C10H21NO2S — CID 88863412
2-amino-3,3,5,5-tetramethyl-6-sulfanylhexanoic acid (PubChem CID 88863412) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 2-amino-3,3,5,5-tetramethyl-6-sulfanylhexanoic acid.
| Compound Name | 2-amino-3,3,5,5-tetramethyl-6-sulfanylhexanoic acid |
|---|---|
| PubChem CID | 88863412 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-amino-3,3,5,5-tetramethyl-6-sulfanylhexanoic acid |
| SMILES | CC(C)(CS)CC(C)(C)C(N)C(=O)O |
| InChI | InChI=1S/C10H21NO2S/c1-9(2,6-14)5-10(3,4)7(11)8(12)13/h7,14H,5-6,11H2,1-4H3,(H,12,13) |
| InChIKey | HCQKSFWSEDNXPW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|