C11H22AsNO4 — CID 173000257
(2S)-2-amino-3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylarsanyl]butanoic acid (PubChem CID 173000257) has the molecular formula C11H22AsNO4 and a molecular weight of 307.22 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylarsanyl]butanoic acid.
| Compound Name | (2S)-2-amino-3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylarsanyl]butanoic acid |
|---|---|
| PubChem CID | 173000257 |
| Molecular Formula | C11H22AsNO4 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylarsanyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)[AsH]CC(C)(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H22AsNO4/c1-10(2,3)17-9(16)12-6-11(4,5)7(13)8(14)15/h7,12H,6,13H2,1-5H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | BZODIPIBSZVNEI-SSDOTTSWSA-N |
| XLogP | 1.21 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|