C21H16BBr2ClN6O4 — CID 88863874
CID 88863874 (PubChem CID 88863874) has the molecular formula C21H16BBr2ClN6O4 and a molecular weight of 622.47 g/mol.
| Compound Name | CID 88863874 |
|---|---|
| PubChem CID | 88863874 |
| Molecular Formula | C21H16BBr2ClN6O4 |
| Molecular Weight | 622.47 g/mol |
| Exact Mass | 619.94 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Br)cc(C(=O)N(CC=C)NC(=O)OC)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C21H16BBr2ClN6O4/c1-3-7-30(29-21(34)35-2)20(33)12-8-11(23)9-13(22)17(12)27-19(32)15-10-16(24)28-31(15)18-14(25)5-4-6-26-18/h3-6,8-10H,1,7H2,2H3,(H,27,32)(H,29,34) |
| InChIKey | YMJSRTPNLXPPGT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|