C56H47NO — CID 88863961
N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxy-2-methylphenyl)naphthalen-1-amine (PubChem CID 88863961) has the molecular formula C56H47NO and a molecular weight of 750.00 g/mol. Its IUPAC name is N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxy-2-methylphenyl)naphthalen-1-amine.
| Compound Name | N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxy-2-methylphenyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 88863961 |
| Molecular Formula | C56H47NO |
| Molecular Weight | 750.00 g/mol |
| Exact Mass | 749.37 |
| IUPAC Name | N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxy-2-methylphenyl)naphthalen-1-amine |
| SMILES | COc1ccc(N(c2ccc(C=C(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2ccc(/C=C/C=C(c3ccccc3)c3ccccc3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C56H47NO/c1-40-22-28-47(29-23-40)54(48-30-24-41(2)25-31-48)39-43-26-33-49(34-27-43)57(55-37-35-50(58-4)38-42(55)3)56-36-32-46(52-19-11-12-20-53(52)56)18-13-21-51(44-14-7-5-8-15-44)45-16-9-6-10-17-45/h5-39H,1-4H3/b18-13+ |
| InChIKey | QZMLRFHHOKGOPQ-QGOAFFKASA-N |
| XLogP | 14.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.00 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|