C18H37O3PS — CID 88870025
7-methyl-7-(3-methylphosphanylpropyl)cyclotridecane-1-sulfonic acid (PubChem CID 88870025) has the molecular formula C18H37O3PS and a molecular weight of 364.53 g/mol. Its IUPAC name is 7-methyl-7-(3-methylphosphanylpropyl)cyclotridecane-1-sulfonic acid.
| Compound Name | 7-methyl-7-(3-methylphosphanylpropyl)cyclotridecane-1-sulfonic acid |
|---|---|
| PubChem CID | 88870025 |
| Molecular Formula | C18H37O3PS |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 7-methyl-7-(3-methylphosphanylpropyl)cyclotridecane-1-sulfonic acid |
| SMILES | CPCCCC1(C)CCCCCCC(S(=O)(=O)O)CCCCC1 |
| InChI | InChI=1S/C18H37O3PS/c1-18(15-10-16-22-2)13-8-4-3-6-11-17(23(19,20)21)12-7-5-9-14-18/h17,22H,3-16H2,1-2H3,(H,19,20,21) |
| InChIKey | OMSGWJTYFWQNFR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|