C17H18Cl2N4O6 — CID 88870943
(3S)-3-[[(2S)-1-[2-[(2,3-dichloropyridine-4-carbonyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 88870943) has the molecular formula C17H18Cl2N4O6 and a molecular weight of 445.26 g/mol. Its IUPAC name is (3S)-3-[[(2S)-1-[2-[(2,3-dichloropyridine-4-carbonyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-1-[2-[(2,3-dichloropyridine-4-carbonyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88870943 |
| Molecular Formula | C17H18Cl2N4O6 |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | (3S)-3-[[(2S)-1-[2-[(2,3-dichloropyridine-4-carbonyl)amino]acetyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)c1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C17H18Cl2N4O6/c18-14-10(3-4-20-15(14)19)16(28)21-7-12(25)23-5-1-2-11(23)17(29)22-9(8-24)6-13(26)27/h3-4,8-9,11H,1-2,5-7H2,(H,21,28)(H,22,29)(H,26,27)/t9-,11-/m0/s1 |
| InChIKey | HQQQAPINHSPBIS-ONGXEEELSA-N |
| XLogP | 0.27 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|