C17H18Cl2N6O2 — CID 88875503
1-(2,6-dichloro-4-pyridinyl)-3-[methyl-(3-methyl-4-propan-2-yl-[1,2]oxazolo[5,4-b]pyridin-6-yl)amino]urea (PubChem CID 88875503) has the molecular formula C17H18Cl2N6O2 and a molecular weight of 409.28 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[methyl-(3-methyl-4-propan-2-yl-[1,2]oxazolo[5,4-b]pyridin-6-yl)amino]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[methyl-(3-methyl-4-propan-2-yl-[1,2]oxazolo[5,4-b]pyridin-6-yl)amino]urea |
|---|---|
| PubChem CID | 88875503 |
| Molecular Formula | C17H18Cl2N6O2 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[methyl-(3-methyl-4-propan-2-yl-[1,2]oxazolo[5,4-b]pyridin-6-yl)amino]urea |
| SMILES | Cc1noc2nc(N(C)NC(=O)Nc3cc(Cl)nc(Cl)c3)cc(C(C)C)c12 |
| InChI | InChI=1S/C17H18Cl2N6O2/c1-8(2)11-7-14(22-16-15(11)9(3)24-27-16)25(4)23-17(26)20-10-5-12(18)21-13(19)6-10/h5-8H,1-4H3,(H2,20,21,23,26) |
| InChIKey | VBNZAVIACIHKGH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|