C22H26Cl2N8 — CID 138675548
(E)-3-[(2,6-dichloro-4-pyridinyl)amino]-3-[2-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-2-propan-2-ylhydrazinyl]prop-2-enenitrile (PubChem CID 138675548) has the molecular formula C22H26Cl2N8 and a molecular weight of 473.41 g/mol. Its IUPAC name is (E)-3-[(2,6-dichloro-4-pyridinyl)amino]-3-[2-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-2-propan-2-ylhydrazinyl]prop-2-enenitrile.
| Compound Name | (E)-3-[(2,6-dichloro-4-pyridinyl)amino]-3-[2-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-2-propan-2-ylhydrazinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 138675548 |
| Molecular Formula | C22H26Cl2N8 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (E)-3-[(2,6-dichloro-4-pyridinyl)amino]-3-[2-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-2-propan-2-ylhydrazinyl]prop-2-enenitrile |
| SMILES | Cc1nn(C)c2nc(N(N/C(=C/C#N)Nc3cc(Cl)nc(Cl)c3)C(C)C)cc(C(C)C)c12 |
| InChI | InChI=1S/C22H26Cl2N8/c1-12(2)16-11-20(28-22-21(16)14(5)29-31(22)6)32(13(3)4)30-19(7-8-25)26-15-9-17(23)27-18(24)10-15/h7,9-13,30H,1-6H3,(H,26,27)/b19-7+ |
| InChIKey | RFGMGQOVDCRMGV-FBCYGCLPSA-N |
| XLogP | 5.30 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|