C12H19N5 — CID 70652054
1-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-2-methylhydrazine (PubChem CID 70652054) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 1-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-2-methylhydrazine.
| Compound Name | 1-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-2-methylhydrazine |
|---|---|
| PubChem CID | 70652054 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-2-methylhydrazine |
| SMILES | CNNc1cc(C(C)C)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C12H19N5/c1-7(2)9-6-10(15-13-4)14-12-11(9)8(3)16-17(12)5/h6-7,13H,1-5H3,(H,14,15) |
| InChIKey | RFSKJTJKNQXLCD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|