C25H28ClN7O2 — CID 10128197
1-[2-chloro-6-(4-ethoxyphenyl)-4-pyridinyl]-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]urea (PubChem CID 10128197) has the molecular formula C25H28ClN7O2 and a molecular weight of 494.00 g/mol. Its IUPAC name is 1-[2-chloro-6-(4-ethoxyphenyl)-4-pyridinyl]-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]urea.
| Compound Name | 1-[2-chloro-6-(4-ethoxyphenyl)-4-pyridinyl]-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
|---|---|
| PubChem CID | 10128197 |
| Molecular Formula | C25H28ClN7O2 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 1-[2-chloro-6-(4-ethoxyphenyl)-4-pyridinyl]-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
| SMILES | CCOc1ccc(-c2cc(NC(=O)NNc3cc(C(C)C)c4c(C)nn(C)c4n3)cc(Cl)n2)cc1 |
| InChI | InChI=1S/C25H28ClN7O2/c1-6-35-18-9-7-16(8-10-18)20-11-17(12-21(26)28-20)27-25(34)31-30-22-13-19(14(2)3)23-15(4)32-33(5)24(23)29-22/h7-14H,6H2,1-5H3,(H,29,30)(H2,27,28,31,34) |
| InChIKey | NRTDESXSXMVLCF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|