C19H21Cl2N6O+ — CID 123183602
1-(2,6-dichloro-4-pyridinyl)-3-[(7-methyl-5-propan-2-yl-8-prop-2-enyl-2-aza-8-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-yl)amino]urea (PubChem CID 123183602) has the molecular formula C19H21Cl2N6O+ and a molecular weight of 420.32 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[(7-methyl-5-propan-2-yl-8-prop-2-enyl-2-aza-8-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-yl)amino]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[(7-methyl-5-propan-2-yl-8-prop-2-enyl-2-aza-8-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-yl)amino]urea |
|---|---|
| PubChem CID | 123183602 |
| Molecular Formula | C19H21Cl2N6O+ |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[(7-methyl-5-propan-2-yl-8-prop-2-enyl-2-aza-8-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-yl)amino]urea |
| SMILES | C=CC[N+]1=c2nc(NNC(=O)Nc3cc(Cl)nc(Cl)c3)cc(C(C)C)c2=C1C |
| InChI | InChI=1S/C19H20Cl2N6O/c1-5-6-27-11(4)17-13(10(2)3)9-16(24-18(17)27)25-26-19(28)22-12-7-14(20)23-15(21)8-12/h5,7-10H,1,6H2,2-4H3,(H2,22,23,26,28)/p+1 |
| InChIKey | JKXPHVKXEHJRDU-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|