C19H24ClN7O2 — CID 52911905
1-(2-chloro-6-ethoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea (PubChem CID 52911905) has the molecular formula C19H24ClN7O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is 1-(2-chloro-6-ethoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea.
| Compound Name | 1-(2-chloro-6-ethoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea |
|---|---|
| PubChem CID | 52911905 |
| Molecular Formula | C19H24ClN7O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-(2-chloro-6-ethoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea |
| SMILES | CCOc1cc(NC(=O)NNc2cc(C(C)C)c3c(n2)c(C)nn3C)cc(Cl)n1 |
| InChI | InChI=1S/C19H24ClN7O2/c1-6-29-16-8-12(7-14(20)22-16)21-19(28)25-24-15-9-13(10(2)3)18-17(23-15)11(4)26-27(18)5/h7-10H,6H2,1-5H3,(H,23,24)(H2,21,22,25,28) |
| InChIKey | AULCVLSAZYSTSD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|