C21H28ClN7O2 — CID 51031007
1-(2-butoxy-6-chloro-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea (PubChem CID 51031007) has the molecular formula C21H28ClN7O2 and a molecular weight of 445.96 g/mol. Its IUPAC name is 1-(2-butoxy-6-chloro-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea.
| Compound Name | 1-(2-butoxy-6-chloro-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea |
|---|---|
| PubChem CID | 51031007 |
| Molecular Formula | C21H28ClN7O2 |
| Molecular Weight | 445.96 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-(2-butoxy-6-chloro-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea |
| SMILES | CCCCOc1cc(NC(=O)NNc2cc(C(C)C)c3c(n2)c(C)nn3C)cc(Cl)n1 |
| InChI | InChI=1S/C21H28ClN7O2/c1-6-7-8-31-18-10-14(9-16(22)24-18)23-21(30)27-26-17-11-15(12(2)3)20-19(25-17)13(4)28-29(20)5/h9-12H,6-8H2,1-5H3,(H,25,26)(H2,23,24,27,30) |
| InChIKey | SVFPVDOPVVESRT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.96 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|