C21H28ClN7O — CID 10181080
1-(2-chloro-6-hexyl-4-pyridinyl)-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea (PubChem CID 10181080) has the molecular formula C21H28ClN7O and a molecular weight of 429.96 g/mol. Its IUPAC name is 1-(2-chloro-6-hexyl-4-pyridinyl)-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea.
| Compound Name | 1-(2-chloro-6-hexyl-4-pyridinyl)-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
|---|---|
| PubChem CID | 10181080 |
| Molecular Formula | C21H28ClN7O |
| Molecular Weight | 429.96 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 1-(2-chloro-6-hexyl-4-pyridinyl)-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
| SMILES | CCCCCCc1cc(NC(=O)NNc2cc(C)c3c(C)nn(C)c3n2)cc(Cl)n1 |
| InChI | InChI=1S/C21H28ClN7O/c1-5-6-7-8-9-15-11-16(12-17(22)23-15)24-21(30)27-26-18-10-13(2)19-14(3)28-29(4)20(19)25-18/h10-12H,5-9H2,1-4H3,(H,25,26)(H2,23,24,27,30) |
| InChIKey | PWPHPPAVEVSROR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.96 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|