C20H26N6O3 — CID 25168669
1-(2,6-dimethoxyphenyl)-3-[(1,3-dimethyl-4-propylpyrazolo[5,4-b]pyridin-6-yl)amino]urea (PubChem CID 25168669) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-3-[(1,3-dimethyl-4-propylpyrazolo[5,4-b]pyridin-6-yl)amino]urea.
| Compound Name | 1-(2,6-dimethoxyphenyl)-3-[(1,3-dimethyl-4-propylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
|---|---|
| PubChem CID | 25168669 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-3-[(1,3-dimethyl-4-propylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
| SMILES | CCCc1cc(NNC(=O)Nc2c(OC)cccc2OC)nc2c1c(C)nn2C |
| InChI | InChI=1S/C20H26N6O3/c1-6-8-13-11-16(21-19-17(13)12(2)25-26(19)3)23-24-20(27)22-18-14(28-4)9-7-10-15(18)29-5/h7,9-11H,6,8H2,1-5H3,(H,21,23)(H2,22,24,27) |
| InChIKey | RFHFOEULCPPXOV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|