C26H36N4O5 — CID 88875802
tert-butyl 4-[[2-[[(3R,4S)-3-nitrosooxan-4-yl]carbamoyl]-5,6,7,8-tetrahydroquinolin-4-yl]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 88875802) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is tert-butyl 4-[[2-[[(3R,4S)-3-nitrosooxan-4-yl]carbamoyl]-5,6,7,8-tetrahydroquinolin-4-yl]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[[(3R,4S)-3-nitrosooxan-4-yl]carbamoyl]-5,6,7,8-tetrahydroquinolin-4-yl]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 88875802 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | tert-butyl 4-[[2-[[(3R,4S)-3-nitrosooxan-4-yl]carbamoyl]-5,6,7,8-tetrahydroquinolin-4-yl]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(Cc2cc(C(=O)N[C@H]3CCOCC3N=O)nc3c2CCCC3)CC1 |
| InChI | InChI=1S/C26H36N4O5/c1-26(2,3)35-25(32)30-11-8-17(9-12-30)14-18-15-22(27-20-7-5-4-6-19(18)20)24(31)28-21-10-13-34-16-23(21)29-33/h8,15,21,23H,4-7,9-14,16H2,1-3H3,(H,28,31)/t21-,23?/m0/s1 |
| InChIKey | LRCUFUNFDJYJTE-BBQAJUCSSA-N |
| XLogP | 3.72 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|