C10H12N2O3 — CID 88879957
(2S)-2-amino-N-formyl-3-(4-hydroxyphenyl)propanamide (PubChem CID 88879957) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is (2S)-2-amino-N-formyl-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-formyl-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 88879957 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (2S)-2-amino-N-formyl-3-(4-hydroxyphenyl)propanamide |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NC=O |
| InChI | InChI=1S/C10H12N2O3/c11-9(10(15)12-6-13)5-7-1-3-8(14)4-2-7/h1-4,6,9,14H,5,11H2,(H,12,13,15)/t9-/m0/s1 |
| InChIKey | VKJOPLBBGJKKRM-VIFPVBQESA-N |
| XLogP | -0.47 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|